RNA Information
| RNA name | Aptamer |
| RNA target ID | Target_6 |
| Source organism | Synthetic |
| Disease involved | - |
| RNA sequence | GGGAAGGGAAGAAACUGCGGCUUCGGCCGGCUUCCC |
| RNA type | RNA aptamer |
| RNA subclass | - |
| Target region | - |
| Secondary structure | ![]() |
| Molecule name | Malachite green |
| Molecule ID | Target_lig_308 |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=CC=C3.[Cl-] |
| IUPAC name | [4-[[4-(dimethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride |
| PubChem CID | 11294 |
| 2D structure | ![]() |
| Radar Plot |
| Ka (M-1) | - |
| Ki (M) | - |
| Kd (M) | 5.00E-08 |
| IC50 (M) | - |
| EC50 (M) | - |
| CD50 (M) | - |
3D structure (Experimental)
| Experimental method | - |
| RNA concentration | - |
| Small molecule concentration | - |
| pH | - |
| Temperature (°C) | - |
| Ions present | - |
| Reference | - |
| Title | - |
| Authors | - |
| Journal | - |
| Volume | - |
| Pages | - |
| Year | - |
|
Copyright © 2022 - All Rights Reserved. The database is maintained by Protein Bioinformatics Lab Department of Biotechnology, Indian Institute of Technology Madras |
![]() |